Pivaloyl chloride is a colorless to pale yellow transparent liquid with a strong pungent and lachrymatory odor. As a highly reactive acylating agent, it contains an acyl chloride (-COCl) functional group and exhibits large steric hindrance. It decomposes violently upon contact with water, releasing hydrogen chloride (HCl) gas.
Physical & Chemical Properties
Molecular FormulaC5H9ClO/(CH3)3CCOCl
Density:0.980g/cm³g/cm³
Boiling Point:105-106℃
Solubility:
It undergoes vigorous hydrolysis upon contact with water and is soluble in most organic solvents such as diethyl ether, benzene, toluene, chloroform, etc.
Molecular Weight:120.58g/mol
Flash Point:8.9℃
Melting Point:-56℃
Uses
1. Pharmaceutical intermediates:Used in the synthesis of semi-synthetic antibiotics and pharmaceuticals such as amoxicillin, cephalexin, cephazolin, and dipivefrin.
2. Pesticide intermediates:Key raw material for the production of the insecticide triazamate and the herbicide isoxaflutole.
3. Organic synthesis:Used as a selective acylating agent and amino protecting group for the synthesis of amides, phenolic esters, tert-butyl peroxypivalate, etc.
4. Photosensitive materials:Used as an intermediate for yellow couplers in photographic organic chemicals.